2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid

C9H13N3O2S — CID 54595165

IUPAC2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid
SMILESCN1CCN(c2ncc(C(=O)O)s2)CC1
InChIInChI=1S/C9H13N3O2S/c1-11-2-4-12(5-3-11)9-10-6-7(15-9)8(13)14/h6H,2-5H2,1H3,(H,13,14)
InChIKeyRKJMEAAQLUOZLB-UHFFFAOYSA-N
MW227.29 g/mol
LogP0.59
Rot. Bonds2

About 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid

2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 54595165) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid
PubChem CID54595165
Molecular FormulaC9H13N3O2S
Molecular Weight227.29 g/mol
Exact Mass227.07
IUPAC Name2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid
SMILESCN1CCN(c2ncc(C(=O)O)s2)CC1
InChIInChI=1S/C9H13N3O2S/c1-11-2-4-12(5-3-11)9-10-6-7(15-9)8(13)14/h6H,2-5H2,1H3,(H,13,14)
InChIKeyRKJMEAAQLUOZLB-UHFFFAOYSA-N
XLogP0.59
TPSA56.67 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.29
LogP ≤ 50.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid (CID 54595165) is 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid is CN1CCN(c2ncc(C(=O)O)s2)CC1.
What is the InChIKey of 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is RKJMEAAQLUOZLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2S/c1-11-2-4-12(5-3-11)9-10-6-7(15-9)8(13)14/h6H,2-5H2,1H3,(H,13,14).
What are the key properties of 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid?
2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 227.29 g/mol, XLogP of 0.59, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 54595165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).