C9H13N3OS — CID 1490234
2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 1490234) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 1490234 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CN1CCN(c2ncc(C=O)s2)CC1 |
| InChI | InChI=1S/C9H13N3OS/c1-11-2-4-12(5-3-11)9-10-6-8(7-13)14-9/h6-7H,2-5H2,1H3 |
| InChIKey | TUJAFVJUJXMFEG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|