C8H8Cl2N2 — CID 54595731
4,6-dichloro-2-cyclopropyl-5-methylpyrimidine (PubChem CID 54595731) has the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. Its IUPAC name is 4,6-dichloro-2-cyclopropyl-5-methylpyrimidine.
| Compound Name | 4,6-dichloro-2-cyclopropyl-5-methylpyrimidine |
|---|---|
| PubChem CID | 54595731 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 4,6-dichloro-2-cyclopropyl-5-methylpyrimidine |
| SMILES | Cc1c(Cl)nc(C2CC2)nc1Cl |
| InChI | InChI=1S/C8H8Cl2N2/c1-4-6(9)11-8(5-2-3-5)12-7(4)10/h5H,2-3H2,1H3 |
| InChIKey | AEKXEKPMZIZYLD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |