C11H13ClFN3 — CID 122191265
6-chloro-2-cyclopropyl-N-(2-fluoroprop-2-enyl)-5-methylpyrimidin-4-amine (PubChem CID 122191265) has the molecular formula C11H13ClFN3 and a molecular weight of 241.70 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-N-(2-fluoroprop-2-enyl)-5-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-N-(2-fluoroprop-2-enyl)-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 122191265 |
| Molecular Formula | C11H13ClFN3 |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 6-chloro-2-cyclopropyl-N-(2-fluoroprop-2-enyl)-5-methylpyrimidin-4-amine |
| SMILES | C=C(F)CNc1nc(C2CC2)nc(Cl)c1C |
| InChI | InChI=1S/C11H13ClFN3/c1-6(13)5-14-10-7(2)9(12)15-11(16-10)8-3-4-8/h8H,1,3-5H2,2H3,(H,14,15,16) |
| InChIKey | URLNZAXHZXPDRT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |