C10H12BrNO3S — CID 54595982
2-(4-bromothiophen-2-yl)-2-morpholin-4-ylacetic acid (PubChem CID 54595982) has the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-2-morpholin-4-ylacetic acid.
| Compound Name | 2-(4-bromothiophen-2-yl)-2-morpholin-4-ylacetic acid |
|---|---|
| PubChem CID | 54595982 |
| Molecular Formula | C10H12BrNO3S |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-2-morpholin-4-ylacetic acid |
| SMILES | O=C(O)C(c1cc(Br)cs1)N1CCOCC1 |
| InChI | InChI=1S/C10H12BrNO3S/c11-7-5-8(16-6-7)9(10(13)14)12-1-3-15-4-2-12/h5-6,9H,1-4H2,(H,13,14) |
| InChIKey | WPGRXFUJUCBGSX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |