C20H15FN4OS — CID 54596195
3-fluoro-N-[3-[(6-methyl-1H-indazol-5-yl)sulfanyl]phenyl]pyridine-4-carboxamide (PubChem CID 54596195) has the molecular formula C20H15FN4OS and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-fluoro-N-[3-[(6-methyl-1H-indazol-5-yl)sulfanyl]phenyl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-[3-[(6-methyl-1H-indazol-5-yl)sulfanyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 54596195 |
| Molecular Formula | C20H15FN4OS |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3-fluoro-N-[3-[(6-methyl-1H-indazol-5-yl)sulfanyl]phenyl]pyridine-4-carboxamide |
| SMILES | Cc1cc2[nH]ncc2cc1Sc1cccc(NC(=O)c2ccncc2F)c1 |
| InChI | InChI=1S/C20H15FN4OS/c1-12-7-18-13(10-23-25-18)8-19(12)27-15-4-2-3-14(9-15)24-20(26)16-5-6-22-11-17(16)21/h2-11H,1H3,(H,23,25)(H,24,26) |
| InChIKey | BAGNNPDYUUHJGJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |