C23H35FO — CID 54596787
2-[(3S,5S,10S,13S,17S)-3-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-3-yn-2-ol (PubChem CID 54596787) has the molecular formula C23H35FO and a molecular weight of 346.53 g/mol. Its IUPAC name is 2-[(3S,5S,10S,13S,17S)-3-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-3-yn-2-ol.
| Compound Name | 2-[(3S,5S,10S,13S,17S)-3-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 54596787 |
| Molecular Formula | C23H35FO |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 2-[(3S,5S,10S,13S,17S)-3-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]but-3-yn-2-ol |
| SMILES | C#CC(C)(O)[C@H]1CCC2C3CC[C@H]4C[C@@H](F)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C23H35FO/c1-5-23(4,25)20-9-8-18-17-7-6-15-14-16(24)10-12-21(15,2)19(17)11-13-22(18,20)3/h1,15-20,25H,6-14H2,2-4H3/t15-,16-,17?,18?,19?,20-,21-,22-,23?/m0/s1 |
| InChIKey | DDMKDMNKGJIDCL-YQZHSWOOSA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|