C19H29NO9S — CID 54596859
[(2S,3S,4R,5R)-2,3,6-triacetyloxy-5-(hexanoylamino)thian-4-yl] acetate (PubChem CID 54596859) has the molecular formula C19H29NO9S and a molecular weight of 447.51 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-2,3,6-triacetyloxy-5-(hexanoylamino)thian-4-yl] acetate.
| Compound Name | [(2S,3S,4R,5R)-2,3,6-triacetyloxy-5-(hexanoylamino)thian-4-yl] acetate |
|---|---|
| PubChem CID | 54596859 |
| Molecular Formula | C19H29NO9S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [(2S,3S,4R,5R)-2,3,6-triacetyloxy-5-(hexanoylamino)thian-4-yl] acetate |
| SMILES | CCCCCC(=O)N[C@H]1C(OC(C)=O)S[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H29NO9S/c1-6-7-8-9-14(25)20-15-16(26-10(2)21)17(27-11(3)22)19(29-13(5)24)30-18(15)28-12(4)23/h15-19H,6-9H2,1-5H3,(H,20,25)/t15-,16-,17+,18?,19+/m1/s1 |
| InChIKey | DOXWWFOJQYIPKC-BBCBXFPWSA-N |
| XLogP | 1.44 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|