C21H17ClF2N6O — CID 54596896
1-[3-chloro-4-[2-[(2,4-difluorophenyl)methylamino]ethyl]phenyl]-3-(5-cyanopyrazin-2-yl)urea (PubChem CID 54596896) has the molecular formula C21H17ClF2N6O and a molecular weight of 442.86 g/mol. Its IUPAC name is 1-[3-chloro-4-[2-[(2,4-difluorophenyl)methylamino]ethyl]phenyl]-3-(5-cyanopyrazin-2-yl)urea.
| Compound Name | 1-[3-chloro-4-[2-[(2,4-difluorophenyl)methylamino]ethyl]phenyl]-3-(5-cyanopyrazin-2-yl)urea |
|---|---|
| PubChem CID | 54596896 |
| Molecular Formula | C21H17ClF2N6O |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 1-[3-chloro-4-[2-[(2,4-difluorophenyl)methylamino]ethyl]phenyl]-3-(5-cyanopyrazin-2-yl)urea |
| SMILES | N#Cc1cnc(NC(=O)Nc2ccc(CCNCc3ccc(F)cc3F)c(Cl)c2)cn1 |
| InChI | InChI=1S/C21H17ClF2N6O/c22-18-8-16(29-21(31)30-20-12-27-17(9-25)11-28-20)4-2-13(18)5-6-26-10-14-1-3-15(23)7-19(14)24/h1-4,7-8,11-12,26H,5-6,10H2,(H2,28,29,30,31) |
| InChIKey | SMNXRNHFIYNCPZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|