C22H20BrFN6O2 — CID 54596349
1-[5-bromo-4-[2-[(4-fluorophenyl)methylamino]ethyl]-2-methoxyphenyl]-3-(5-cyanopyrazin-2-yl)urea (PubChem CID 54596349) has the molecular formula C22H20BrFN6O2 and a molecular weight of 499.34 g/mol. Its IUPAC name is 1-[5-bromo-4-[2-[(4-fluorophenyl)methylamino]ethyl]-2-methoxyphenyl]-3-(5-cyanopyrazin-2-yl)urea.
| Compound Name | 1-[5-bromo-4-[2-[(4-fluorophenyl)methylamino]ethyl]-2-methoxyphenyl]-3-(5-cyanopyrazin-2-yl)urea |
|---|---|
| PubChem CID | 54596349 |
| Molecular Formula | C22H20BrFN6O2 |
| Molecular Weight | 499.34 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 1-[5-bromo-4-[2-[(4-fluorophenyl)methylamino]ethyl]-2-methoxyphenyl]-3-(5-cyanopyrazin-2-yl)urea |
| SMILES | COc1cc(CCNCc2ccc(F)cc2)c(Br)cc1NC(=O)Nc1cnc(C#N)cn1 |
| InChI | InChI=1S/C22H20BrFN6O2/c1-32-20-8-15(6-7-26-11-14-2-4-16(24)5-3-14)18(23)9-19(20)29-22(31)30-21-13-27-17(10-25)12-28-21/h2-5,8-9,12-13,26H,6-7,11H2,1H3,(H2,28,29,30,31) |
| InChIKey | UQPLTBVHQONTRR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|