C21H24N4O3S — CID 54597160
(1R)-2-[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]amino]-1-phenylethanol (PubChem CID 54597160) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is (1R)-2-[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]amino]-1-phenylethanol.
| Compound Name | (1R)-2-[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]amino]-1-phenylethanol |
|---|---|
| PubChem CID | 54597160 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (1R)-2-[[3-amino-6-(4-propan-2-ylsulfonylphenyl)pyrazin-2-yl]amino]-1-phenylethanol |
| SMILES | CC(C)S(=O)(=O)c1ccc(-c2cnc(N)c(NC[C@H](O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H24N4O3S/c1-14(2)29(27,28)17-10-8-15(9-11-17)18-12-23-20(22)21(25-18)24-13-19(26)16-6-4-3-5-7-16/h3-12,14,19,26H,13H2,1-2H3,(H2,22,23)(H,24,25)/t19-/m0/s1 |
| InChIKey | OCYVVMOJDBDQDB-IBGZPJMESA-N |
| XLogP | 3.05 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |