C22H21Cl2FN6O — CID 54597316
7-[(2,6-dichloro-3-fluorophenyl)-methoxymethyl]-2-(1-piperidin-4-ylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 54597316) has the molecular formula C22H21Cl2FN6O and a molecular weight of 475.36 g/mol. Its IUPAC name is 7-[(2,6-dichloro-3-fluorophenyl)-methoxymethyl]-2-(1-piperidin-4-ylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine.
| Compound Name | 7-[(2,6-dichloro-3-fluorophenyl)-methoxymethyl]-2-(1-piperidin-4-ylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 54597316 |
| Molecular Formula | C22H21Cl2FN6O |
| Molecular Weight | 475.36 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 7-[(2,6-dichloro-3-fluorophenyl)-methoxymethyl]-2-(1-piperidin-4-ylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | COC(c1c(Cl)ccc(F)c1Cl)c1c[nH]c2ncc(-c3cnn(C4CCNCC4)c3)nc12 |
| InChI | InChI=1S/C22H21Cl2FN6O/c1-32-21(18-15(23)2-3-16(25)19(18)24)14-9-27-22-20(14)30-17(10-28-22)12-8-29-31(11-12)13-4-6-26-7-5-13/h2-3,8-11,13,21,26H,4-7H2,1H3,(H,27,28) |
| InChIKey | JSCAEPXEDQAPQU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|