C20H34O2Si — CID 54598184
3-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-9-one (PubChem CID 54598184) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-9-one.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-9-one |
|---|---|
| PubChem CID | 54598184 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-1,5,5-trimethylspiro[5.5]undeca-1,10-dien-9-one |
| SMILES | CC1=CC(O[Si](C)(C)C(C)(C)C)CC(C)(C)C12C=CC(=O)CC2 |
| InChI | InChI=1S/C20H34O2Si/c1-15-13-17(22-23(7,8)18(2,3)4)14-19(5,6)20(15)11-9-16(21)10-12-20/h9,11,13,17H,10,12,14H2,1-8H3 |
| InChIKey | VLELNDJVHONWBV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|