C7H14O7 — CID 5459879
(3S,4R,5R,6R)-1,3,4,5,6,7-hexahydroxyheptan-2-one (PubChem CID 5459879) has the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. Its IUPAC name is (3S,4R,5R,6R)-1,3,4,5,6,7-hexahydroxyheptan-2-one.
| Compound Name | (3S,4R,5R,6R)-1,3,4,5,6,7-hexahydroxyheptan-2-one |
|---|---|
| PubChem CID | 5459879 |
| Molecular Formula | C7H14O7 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | (3S,4R,5R,6R)-1,3,4,5,6,7-hexahydroxyheptan-2-one |
| SMILES | O=C(CO)[C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7-/m1/s1 |
| InChIKey | HSNZZMHEPUFJNZ-SHUUEZRQSA-N |
| XLogP | -4.02 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |