C13H18N3NaO3P+ — CID 54599026
sodium 3-[4-[bis(aziridin-1-yl)phosphorylamino]phenyl]propanoic acid (PubChem CID 54599026) has the molecular formula C13H18N3NaO3P+ and a molecular weight of 318.27 g/mol. Its IUPAC name is sodium 3-[4-[bis(aziridin-1-yl)phosphorylamino]phenyl]propanoic acid.
| Compound Name | sodium 3-[4-[bis(aziridin-1-yl)phosphorylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 54599026 |
| Molecular Formula | C13H18N3NaO3P+ |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | sodium 3-[4-[bis(aziridin-1-yl)phosphorylamino]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(NP(=O)(N2CC2)N2CC2)cc1.[Na+] |
| InChI | InChI=1S/C13H18N3O3P.Na/c17-13(18)6-3-11-1-4-12(5-2-11)14-20(19,15-7-8-15)16-9-10-16;/h1-2,4-5H,3,6-10H2,(H,14,19)(H,17,18);/q;+1 |
| InChIKey | IUVQNYGBKVWIIE-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|