C4H8NaO6S4+ — CID 54600760
sodium (Z)-1,4-bis(sulfosulfanyl)but-2-ene (PubChem CID 54600760) has the molecular formula C4H8NaO6S4+ and a molecular weight of 303.36 g/mol. Its IUPAC name is sodium (Z)-1,4-bis(sulfosulfanyl)but-2-ene.
| Compound Name | sodium (Z)-1,4-bis(sulfosulfanyl)but-2-ene |
|---|---|
| PubChem CID | 54600760 |
| Molecular Formula | C4H8NaO6S4+ |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 302.91 |
| IUPAC Name | sodium (Z)-1,4-bis(sulfosulfanyl)but-2-ene |
| SMILES | O=S(=O)(O)SC/C=C\CSS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C4H8O6S4.Na/c5-13(6,7)11-3-1-2-4-12-14(8,9)10;/h1-2H,3-4H2,(H,5,6,7)(H,8,9,10);/q;+1/b2-1-; |
| InChIKey | YZRFKCVXGXUTPE-ODZAUARKSA-N |
| XLogP | -2.38 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|