C3H6NNaO5S2 — CID 140887346
sodium (2S)-2-amino-3-sulfosulfanylpropanoate (PubChem CID 140887346) has the molecular formula C3H6NNaO5S2 and a molecular weight of 223.21 g/mol. Its IUPAC name is sodium (2S)-2-amino-3-sulfosulfanylpropanoate.
| Compound Name | sodium (2S)-2-amino-3-sulfosulfanylpropanoate |
|---|---|
| PubChem CID | 140887346 |
| Molecular Formula | C3H6NNaO5S2 |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 222.96 |
| IUPAC Name | sodium (2S)-2-amino-3-sulfosulfanylpropanoate |
| SMILES | N[C@H](CSS(=O)(=O)O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H7NO5S2.Na/c4-2(3(5)6)1-10-11(7,8)9;/h2H,1,4H2,(H,5,6)(H,7,8,9);/q;+1/p-1/t2-;/m1./s1 |
| InChIKey | DQFVBELGDROGDO-HSHFZTNMSA-M |
| XLogP | -5.40 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | -5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|