C5H9NO6S2 — CID 22123354
2-amino-3-(carboxymethylsulfonylsulfanyl)propanoic acid (PubChem CID 22123354) has the molecular formula C5H9NO6S2 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-amino-3-(carboxymethylsulfonylsulfanyl)propanoic acid.
| Compound Name | 2-amino-3-(carboxymethylsulfonylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 22123354 |
| Molecular Formula | C5H9NO6S2 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 2-amino-3-(carboxymethylsulfonylsulfanyl)propanoic acid |
| SMILES | NC(CSS(=O)(=O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO6S2/c6-3(5(9)10)1-13-14(11,12)2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | UGYKXRTWZKUAKX-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|