C5H10NO3S2- — CID 6857709
(2R)-2-amino-3-(2-hydroxyethyldisulfanyl)propanoate (PubChem CID 6857709) has the molecular formula C5H10NO3S2- and a molecular weight of 196.27 g/mol. Its IUPAC name is (2R)-2-amino-3-(2-hydroxyethyldisulfanyl)propanoate.
| Compound Name | (2R)-2-amino-3-(2-hydroxyethyldisulfanyl)propanoate |
|---|---|
| PubChem CID | 6857709 |
| Molecular Formula | C5H10NO3S2- |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | (2R)-2-amino-3-(2-hydroxyethyldisulfanyl)propanoate |
| SMILES | N[C@@H](CSSCCO)C(=O)[O-] |
| InChI | InChI=1S/C5H11NO3S2/c6-4(5(8)9)3-11-10-2-1-7/h4,7H,1-3,6H2,(H,8,9)/p-1/t4-/m0/s1 |
| InChIKey | YPUBRSXDQSFQBA-BYPYZUCNSA-M |
| XLogP | -1.56 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|