C25H37N3O4S — CID 54602545
4-methylbenzenesulfonate;1-methyl-N-[(E)-undecan-2-ylideneamino]pyridin-1-ium-3-carboxamide (PubChem CID 54602545) has the molecular formula C25H37N3O4S and a molecular weight of 475.66 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;1-methyl-N-[(E)-undecan-2-ylideneamino]pyridin-1-ium-3-carboxamide.
| Compound Name | 4-methylbenzenesulfonate;1-methyl-N-[(E)-undecan-2-ylideneamino]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 54602545 |
| Molecular Formula | C25H37N3O4S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 4-methylbenzenesulfonate;1-methyl-N-[(E)-undecan-2-ylideneamino]pyridin-1-ium-3-carboxamide |
| SMILES | CCCCCCCCC/C(C)=N/NC(=O)c1ccc[n+](C)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C18H29N3O.C7H8O3S/c1-4-5-6-7-8-9-10-12-16(2)19-20-18(22)17-13-11-14-21(3)15-17;1-6-2-4-7(5-3-6)11(8,9)10/h11,13-15H,4-10,12H2,1-3H3;2-5H,1H3,(H,8,9,10)/b19-16+; |
| InChIKey | PCHBPTCWJHGVAY-PXMDEAMVSA-N |
| XLogP | 4.66 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|