(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid

C5H10O6 — CID 5460677

IUPAC(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid
SMILESO=C(O)[C@H](O)[C@H](O)[C@H](O)CO
InChIInChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3-,4-/m1/s1
InChIKeyQXKAIJAYHKCRRA-BXXZVTAOSA-N
MW166.13 g/mol
LogP-2.85
Rot. Bonds4

About (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid

(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid (PubChem CID 5460677) has the molecular formula C5H10O6 and a molecular weight of 166.13 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid.

Molecular Properties

Compound Name(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid
PubChem CID5460677
Molecular FormulaC5H10O6
Molecular Weight166.13 g/mol
Exact Mass166.05
IUPAC Name(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid
SMILESO=C(O)[C@H](O)[C@H](O)[C@H](O)CO
InChIInChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3-,4-/m1/s1
InChIKeyQXKAIJAYHKCRRA-BXXZVTAOSA-N
XLogP-2.85
TPSA118.22 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.13
LogP ≤ 5-2.85
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid?
The IUPAC name of (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid (CID 5460677) is (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid.
What is the SMILES notation for (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid?
The canonical SMILES for (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid is O=C(O)[C@H](O)[C@H](O)[C@H](O)CO.
What is the InChIKey of (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid?
The InChIKey is QXKAIJAYHKCRRA-BXXZVTAOSA-N. The full InChI is InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3-,4-/m1/s1.
What are the key properties of (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid?
(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid has a molecular weight of 166.13 g/mol, XLogP of -2.85, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid is sourced from PubChem (CID 5460677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).