C32H47ClN6 — CID 54607641
1-N,7-N-bis[1-(diethylamino)propan-2-yl]-3,9-dimethylquinolino[8,7-h]quinoline-1,7-diamine;hydrochloride (PubChem CID 54607641) has the molecular formula C32H47ClN6 and a molecular weight of 551.22 g/mol. Its IUPAC name is 1-N,7-N-bis[1-(diethylamino)propan-2-yl]-3,9-dimethylquinolino[8,7-h]quinoline-1,7-diamine;hydrochloride.
| Compound Name | 1-N,7-N-bis[1-(diethylamino)propan-2-yl]-3,9-dimethylquinolino[8,7-h]quinoline-1,7-diamine;hydrochloride |
|---|---|
| PubChem CID | 54607641 |
| Molecular Formula | C32H47ClN6 |
| Molecular Weight | 551.22 g/mol |
| Exact Mass | 550.36 |
| IUPAC Name | 1-N,7-N-bis[1-(diethylamino)propan-2-yl]-3,9-dimethylquinolino[8,7-h]quinoline-1,7-diamine;hydrochloride |
| SMILES | CCN(CC)CC(C)Nc1cc(C)nc2c1ccc1c2ccc2c(NC(C)CN(CC)CC)cc(C)nc21.Cl |
| InChI | InChI=1S/C32H46N6.ClH/c1-9-37(10-2)19-23(7)33-29-17-21(5)35-31-25-14-16-28-30(34-24(8)20-38(11-3)12-4)18-22(6)36-32(28)26(25)13-15-27(29)31;/h13-18,23-24H,9-12,19-20H2,1-8H3,(H,33,35)(H,34,36);1H |
| InChIKey | YRQRCFGCZBGHMM-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.22 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|