About 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride
2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride (PubChem CID 54612263) has the molecular formula C6H14ClN3
and a molecular weight of 163.65 g/mol. Its IUPAC name is 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride |
| PubChem CID | 54612263 |
| Molecular Formula | C6H14ClN3 |
| Molecular Weight | 163.65 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride |
| SMILES | CC1=NCCN1CCN.Cl |
| InChI | InChI=1S/C6H13N3.ClH/c1-6-8-3-5-9(6)4-2-7;/h2-5,7H2,1H3;1H |
| InChIKey | IDPHEKGLAGRIQO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.65 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride?
The IUPAC name of 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride (CID 54612263) is 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride.
What is the SMILES notation for 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride?
The canonical SMILES for 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride is CC1=NCCN1CCN.Cl.
What is the InChIKey of 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride?
The InChIKey is IDPHEKGLAGRIQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3.ClH/c1-6-8-3-5-9(6)4-2-7;/h2-5,7H2,1H3;1H.
What are the key properties of 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride?
2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride has a molecular weight of 163.65 g/mol, XLogP of 0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-4,5-dihydroimidazol-1-yl)ethanamine;hydrochloride is sourced from PubChem (CID 54612263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).