C18H21NO3 — CID 54612380
(Z)-4-(8,9-dimethoxy-2,3,5,6-tetrahydropyrrolo[2,1-a]isoquinolin-1-yl)but-3-en-2-one (PubChem CID 54612380) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (Z)-4-(8,9-dimethoxy-2,3,5,6-tetrahydropyrrolo[2,1-a]isoquinolin-1-yl)but-3-en-2-one.
| Compound Name | (Z)-4-(8,9-dimethoxy-2,3,5,6-tetrahydropyrrolo[2,1-a]isoquinolin-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 54612380 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (Z)-4-(8,9-dimethoxy-2,3,5,6-tetrahydropyrrolo[2,1-a]isoquinolin-1-yl)but-3-en-2-one |
| SMILES | COc1cc2c(cc1OC)C1=C(/C=C\C(C)=O)CCN1CC2 |
| InChI | InChI=1S/C18H21NO3/c1-12(20)4-5-13-6-8-19-9-7-14-10-16(21-2)17(22-3)11-15(14)18(13)19/h4-5,10-11H,6-9H2,1-3H3/b5-4- |
| InChIKey | CHZHRUHJUQVFLH-PLNGDYQASA-N |
| XLogP | 2.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|