C21H20ClNO3 — CID 6227120
(E)-3-(3-chlorophenyl)-1-(6,7-dimethoxy-1-methylidene-3,4-dihydroisoquinolin-2-yl)prop-2-en-1-one (PubChem CID 6227120) has the molecular formula C21H20ClNO3 and a molecular weight of 369.85 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-1-(6,7-dimethoxy-1-methylidene-3,4-dihydroisoquinolin-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-chlorophenyl)-1-(6,7-dimethoxy-1-methylidene-3,4-dihydroisoquinolin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6227120 |
| Molecular Formula | C21H20ClNO3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-1-(6,7-dimethoxy-1-methylidene-3,4-dihydroisoquinolin-2-yl)prop-2-en-1-one |
| SMILES | C=C1c2cc(OC)c(OC)cc2CCN1C(=O)/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H20ClNO3/c1-14-18-13-20(26-3)19(25-2)12-16(18)9-10-23(14)21(24)8-7-15-5-4-6-17(22)11-15/h4-8,11-13H,1,9-10H2,2-3H3/b8-7+ |
| InChIKey | FCDHADIJZBSCTE-BQYQJAHWSA-N |
| XLogP | 4.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|