C21H22N4O3 — CID 54612865
3-[[3-[2-(dimethylamino)ethylcarbamoyl]-2-pyridinyl]amino]naphthalene-2-carboxylic acid (PubChem CID 54612865) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[[3-[2-(dimethylamino)ethylcarbamoyl]-2-pyridinyl]amino]naphthalene-2-carboxylic acid.
| Compound Name | 3-[[3-[2-(dimethylamino)ethylcarbamoyl]-2-pyridinyl]amino]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 54612865 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-[[3-[2-(dimethylamino)ethylcarbamoyl]-2-pyridinyl]amino]naphthalene-2-carboxylic acid |
| SMILES | CN(C)CCNC(=O)c1cccnc1Nc1cc2ccccc2cc1C(=O)O |
| InChI | InChI=1S/C21H22N4O3/c1-25(2)11-10-23-20(26)16-8-5-9-22-19(16)24-18-13-15-7-4-3-6-14(15)12-17(18)21(27)28/h3-9,12-13H,10-11H2,1-2H3,(H,22,24)(H,23,26)(H,27,28) |
| InChIKey | HUEMADDPZVLWKR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |