C22H17N3O3S — CID 54612981
4-[6-oxo-3-(4-phenylphenyl)pyridazin-1-yl]benzenesulfonamide (PubChem CID 54612981) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is 4-[6-oxo-3-(4-phenylphenyl)pyridazin-1-yl]benzenesulfonamide.
| Compound Name | 4-[6-oxo-3-(4-phenylphenyl)pyridazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 54612981 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 4-[6-oxo-3-(4-phenylphenyl)pyridazin-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(-c3ccc(-c4ccccc4)cc3)ccc2=O)cc1 |
| InChI | InChI=1S/C22H17N3O3S/c23-29(27,28)20-12-10-19(11-13-20)25-22(26)15-14-21(24-25)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h1-15H,(H2,23,27,28) |
| InChIKey | RBVXYPBWSOCRQE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |