C15H12FN3O2S — CID 10734248
4-(4-fluoro-5-phenylpyrazol-1-yl)benzenesulfonamide (PubChem CID 10734248) has the molecular formula C15H12FN3O2S and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-(4-fluoro-5-phenylpyrazol-1-yl)benzenesulfonamide.
| Compound Name | 4-(4-fluoro-5-phenylpyrazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 10734248 |
| Molecular Formula | C15H12FN3O2S |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-(4-fluoro-5-phenylpyrazol-1-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2ncc(F)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12FN3O2S/c16-14-10-18-19(15(14)11-4-2-1-3-5-11)12-6-8-13(9-7-12)22(17,20)21/h1-10H,(H2,17,20,21) |
| InChIKey | YQLWJESVKCCSDD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |