C23H21N5O4S — CID 155815132
1-(4-methoxyphenyl)-3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-4-yl]urea (PubChem CID 155815132) has the molecular formula C23H21N5O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-4-yl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 155815132 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-4-yl]urea |
| SMILES | COc1ccc(NC(=O)Nc2cnn(-c3ccc(S(N)(=O)=O)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N5O4S/c1-32-19-11-7-17(8-12-19)26-23(29)27-21-15-25-28(22(21)16-5-3-2-4-6-16)18-9-13-20(14-10-18)33(24,30)31/h2-15H,1H3,(H2,24,30,31)(H2,26,27,29) |
| InChIKey | QLOAPWNDBQNOBX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |