C23H17Cl3N4O2 — CID 3731288
1-(4-methoxyphenyl)-3-[5-phenyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]urea (PubChem CID 3731288) has the molecular formula C23H17Cl3N4O2 and a molecular weight of 487.77 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[5-phenyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[5-phenyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 3731288 |
| Molecular Formula | C23H17Cl3N4O2 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[5-phenyl-1-(2,4,6-trichlorophenyl)pyrazol-4-yl]urea |
| SMILES | COc1ccc(NC(=O)Nc2cnn(-c3c(Cl)cc(Cl)cc3Cl)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17Cl3N4O2/c1-32-17-9-7-16(8-10-17)28-23(31)29-20-13-27-30(21(20)14-5-3-2-4-6-14)22-18(25)11-15(24)12-19(22)26/h2-13H,1H3,(H2,28,29,31) |
| InChIKey | BGKORULTAIGJKD-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |