C25H35N3O5S — CID 54614047
N-[(2S,3S)-2-[(dimethylamino)methyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-4-methylbenzenesulfonamide (PubChem CID 54614047) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is N-[(2S,3S)-2-[(dimethylamino)methyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S,3S)-2-[(dimethylamino)methyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 54614047 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N-[(2S,3S)-2-[(dimethylamino)methyl]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)CC(=O)N([C@H](C)CO)C[C@H](C)[C@@H](CN(C)C)O3)cc1 |
| InChI | InChI=1S/C25H35N3O5S/c1-17-6-9-22(10-7-17)34(31,32)26-21-8-11-23-20(12-21)13-25(30)28(19(3)16-29)14-18(2)24(33-23)15-27(4)5/h6-12,18-19,24,26,29H,13-16H2,1-5H3/t18-,19+,24+/m0/s1 |
| InChIKey | GJDDCVVUYDCWDJ-XLNZFTOWSA-N |
| XLogP | 2.51 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |