C24H33N3O5S — CID 44502018
N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-(methylaminomethyl)-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-4-methylbenzenesulfonamide (PubChem CID 44502018) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-(methylaminomethyl)-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-(methylaminomethyl)-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 44502018 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-(methylaminomethyl)-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]-4-methylbenzenesulfonamide |
| SMILES | CNC[C@H]1Oc2ccc(NS(=O)(=O)c3ccc(C)cc3)cc2CC(=O)N([C@@H](C)CO)C[C@H]1C |
| InChI | InChI=1S/C24H33N3O5S/c1-16-5-8-21(9-6-16)33(30,31)26-20-7-10-22-19(11-20)12-24(29)27(18(3)15-28)14-17(2)23(32-22)13-25-4/h5-11,17-18,23,25-26,28H,12-15H2,1-4H3/t17-,18+,23-/m1/s1 |
| InChIKey | GWFBEMQSOCTAIO-IEGUWTFLSA-N |
| XLogP | 2.16 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |