C23H30FN3O5S — CID 44504068
4-fluoro-N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-(methylaminomethyl)-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]benzenesulfonamide (PubChem CID 44504068) has the molecular formula C23H30FN3O5S and a molecular weight of 479.57 g/mol. Its IUPAC name is 4-fluoro-N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-(methylaminomethyl)-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-(methylaminomethyl)-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 44504068 |
| Molecular Formula | C23H30FN3O5S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 4-fluoro-N-[(2S,3R)-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-2-(methylaminomethyl)-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-9-yl]benzenesulfonamide |
| SMILES | CNC[C@H]1Oc2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2CC(=O)N([C@@H](C)CO)C[C@H]1C |
| InChI | InChI=1S/C23H30FN3O5S/c1-15-13-27(16(2)14-28)23(29)11-17-10-19(6-9-21(17)32-22(15)12-25-3)26-33(30,31)20-7-4-18(24)5-8-20/h4-10,15-16,22,25-26,28H,11-14H2,1-3H3/t15-,16+,22-/m1/s1 |
| InChIKey | BSVDSSJFUCOKCC-ZMPRRUGASA-N |
| XLogP | 1.99 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |