C20H28N2 — CID 5461842
N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine (PubChem CID 5461842) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 5461842 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine |
| SMILES | Cc1cc(C)c(NCCNc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C20H28N2/c1-13-9-15(3)19(16(4)10-13)21-7-8-22-20-17(5)11-14(2)12-18(20)6/h9-12,21-22H,7-8H2,1-6H3 |
| InChIKey | RQXQQXIIAQTDHU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|