About 6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione
6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione (PubChem CID 546194) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione.
Analyze 6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione?
The IUPAC name of 6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione (CID 546194) is 6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione.
What is the SMILES notation for 6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione?
The canonical SMILES for 6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione is CCC12OC(=O)CC1CC(=O)O2.
What is the InChIKey of 6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione?
The InChIKey is JVCVSQUBUBLCSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-2-8-5(3-6(9)11-8)4-7(10)12-8/h5H,2-4H2,1H3.
What are the key properties of 6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione?
6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione has a molecular weight of 170.16 g/mol, XLogP of 0.60, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6a-ethyl-3a,4-dihydro-3H-furo[2,3-b]furan-2,5-dione is sourced from PubChem (CID 546194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).