C21H28BrN3O4S — CID 54621016
(2R)-2-[(4R,5S)-8-bromo-4-methyl-5-[[methyl(pyridin-2-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54621016) has the molecular formula C21H28BrN3O4S and a molecular weight of 498.44 g/mol. Its IUPAC name is (2R)-2-[(4R,5S)-8-bromo-4-methyl-5-[[methyl(pyridin-2-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4R,5S)-8-bromo-4-methyl-5-[[methyl(pyridin-2-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54621016 |
| Molecular Formula | C21H28BrN3O4S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | (2R)-2-[(4R,5S)-8-bromo-4-methyl-5-[[methyl(pyridin-2-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | C[C@@H]1CN([C@H](C)CO)S(=O)(=O)c2ccc(Br)cc2O[C@@H]1CN(C)Cc1ccccn1 |
| InChI | InChI=1S/C21H28BrN3O4S/c1-15-11-25(16(2)14-26)30(27,28)21-8-7-17(22)10-19(21)29-20(15)13-24(3)12-18-6-4-5-9-23-18/h4-10,15-16,20,26H,11-14H2,1-3H3/t15-,16-,20-/m1/s1 |
| InChIKey | GYAWJRHAHFFNSG-JXXFODFXSA-N |
| XLogP | 2.74 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |