C16H25BrN2O4S — CID 54623282
(2R)-2-[(4R,5R)-8-bromo-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54623282) has the molecular formula C16H25BrN2O4S and a molecular weight of 421.36 g/mol. Its IUPAC name is (2R)-2-[(4R,5R)-8-bromo-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4R,5R)-8-bromo-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54623282 |
| Molecular Formula | C16H25BrN2O4S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | (2R)-2-[(4R,5R)-8-bromo-5-[(dimethylamino)methyl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | C[C@@H]1CN([C@H](C)CO)S(=O)(=O)c2ccc(Br)cc2O[C@H]1CN(C)C |
| InChI | InChI=1S/C16H25BrN2O4S/c1-11-8-19(12(2)10-20)24(21,22)16-6-5-13(17)7-14(16)23-15(11)9-18(3)4/h5-7,11-12,15,20H,8-10H2,1-4H3/t11-,12-,15+/m1/s1 |
| InChIKey | FFJTYWMSXJQJGU-JMSVASOKSA-N |
| XLogP | 1.78 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |