C23H35N3O6S — CID 54624557
N-[[(4R,5S)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-2-methoxy-N-methylacetamide (PubChem CID 54624557) has the molecular formula C23H35N3O6S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[[(4R,5S)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-2-methoxy-N-methylacetamide.
| Compound Name | N-[[(4R,5S)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-2-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 54624557 |
| Molecular Formula | C23H35N3O6S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-[[(4R,5S)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-2-methoxy-N-methylacetamide |
| SMILES | COCC(=O)N(C)C[C@H]1Oc2cc(C#CCN(C)C)ccc2S(=O)(=O)N([C@@H](C)CO)C[C@H]1C |
| InChI | InChI=1S/C23H35N3O6S/c1-17-13-26(18(2)15-27)33(29,30)22-10-9-19(8-7-11-24(3)4)12-20(22)32-21(17)14-25(5)23(28)16-31-6/h9-10,12,17-18,21,27H,11,13-16H2,1-6H3/t17-,18+,21-/m1/s1 |
| InChIKey | GEMOEUXAAXRSAY-LVCYWYKZSA-N |
| XLogP | 0.47 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|