C24H35N3O5S — CID 54628366
N-[[(4R,5S)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylcyclopropanecarboxamide (PubChem CID 54628366) has the molecular formula C24H35N3O5S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-[[(4R,5S)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylcyclopropanecarboxamide.
| Compound Name | N-[[(4R,5S)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 54628366 |
| Molecular Formula | C24H35N3O5S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | N-[[(4R,5S)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylcyclopropanecarboxamide |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C#CCN(C)C)cc2O[C@@H]1CN(C)C(=O)C1CC1 |
| InChI | InChI=1S/C24H35N3O5S/c1-17-14-27(18(2)16-28)33(30,31)23-11-8-19(7-6-12-25(3)4)13-21(23)32-22(17)15-26(5)24(29)20-9-10-20/h8,11,13,17-18,20,22,28H,9-10,12,14-16H2,1-5H3/t17-,18+,22-/m1/s1 |
| InChIKey | GRDSFRVDCUTAPS-KGVIQGDOSA-N |
| XLogP | 1.24 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|