C27H40N2O6S — CID 54629706
N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyloxane-4-carboxamide (PubChem CID 54629706) has the molecular formula C27H40N2O6S and a molecular weight of 520.69 g/mol. Its IUPAC name is N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyloxane-4-carboxamide.
| Compound Name | N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyloxane-4-carboxamide |
|---|---|
| PubChem CID | 54629706 |
| Molecular Formula | C27H40N2O6S |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyloxane-4-carboxamide |
| SMILES | CC(C)CC#Cc1ccc2c(c1)O[C@@H](CN(C)C(=O)C1CCOCC1)[C@H](C)CN([C@@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C27H40N2O6S/c1-19(2)7-6-8-22-9-10-26-24(15-22)35-25(17-28(5)27(31)23-11-13-34-14-12-23)20(3)16-29(21(4)18-30)36(26,32)33/h9-10,15,19-21,23,25,30H,7,11-14,16-18H2,1-5H3/t20-,21+,25+/m1/s1 |
| InChIKey | QPOBIWTVIRBYPL-CZSZKKDXSA-N |
| XLogP | 2.74 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|