C29H34N2O5S — CID 54625443
N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-phenyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-phenylacetamide (PubChem CID 54625443) has the molecular formula C29H34N2O5S and a molecular weight of 522.67 g/mol. Its IUPAC name is N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-phenyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-phenylacetamide.
| Compound Name | N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-phenyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 54625443 |
| Molecular Formula | C29H34N2O5S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | N-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-phenyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methyl-2-phenylacetamide |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(-c3ccccc3)cc2O[C@@H]1CN(C)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H34N2O5S/c1-21-18-31(22(2)20-32)37(34,35)28-15-14-25(24-12-8-5-9-13-24)17-26(28)36-27(21)19-30(3)29(33)16-23-10-6-4-7-11-23/h4-15,17,21-22,27,32H,16,18-20H2,1-3H3/t21-,22+,27-/m1/s1 |
| InChIKey | NNKABUJEVILKFB-UMTXDNHDSA-N |
| XLogP | 3.82 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |