C28H31FN2O5S — CID 54628335
2-fluoro-N-[[(4R,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-phenyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzamide (PubChem CID 54628335) has the molecular formula C28H31FN2O5S and a molecular weight of 526.63 g/mol. Its IUPAC name is 2-fluoro-N-[[(4R,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-phenyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzamide.
| Compound Name | 2-fluoro-N-[[(4R,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-phenyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 54628335 |
| Molecular Formula | C28H31FN2O5S |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 2-fluoro-N-[[(4R,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-8-phenyl-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylbenzamide |
| SMILES | C[C@@H]1CN([C@H](C)CO)S(=O)(=O)c2ccc(-c3ccccc3)cc2O[C@@H]1CN(C)C(=O)c1ccccc1F |
| InChI | InChI=1S/C28H31FN2O5S/c1-19-16-31(20(2)18-32)37(34,35)27-14-13-22(21-9-5-4-6-10-21)15-25(27)36-26(19)17-30(3)28(33)23-11-7-8-12-24(23)29/h4-15,19-20,26,32H,16-18H2,1-3H3/t19-,20-,26-/m1/s1 |
| InChIKey | QRFZZKLBUYSUDS-XMERXJNXSA-N |
| XLogP | 4.03 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |