C25H39N3O5S — CID 54626268
1-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methyl-3-propylurea (PubChem CID 54626268) has the molecular formula C25H39N3O5S and a molecular weight of 493.67 g/mol. Its IUPAC name is 1-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methyl-3-propylurea.
| Compound Name | 1-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methyl-3-propylurea |
|---|---|
| PubChem CID | 54626268 |
| Molecular Formula | C25H39N3O5S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 1-[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methyl-3-propylurea |
| SMILES | CCCNC(=O)N(C)C[C@H]1Oc2cc(C#CCC(C)C)ccc2S(=O)(=O)N([C@@H](C)CO)C[C@H]1C |
| InChI | InChI=1S/C25H39N3O5S/c1-7-13-26-25(30)27(6)16-23-19(4)15-28(20(5)17-29)34(31,32)24-12-11-21(14-22(24)33-23)10-8-9-18(2)3/h11-12,14,18-20,23,29H,7,9,13,15-17H2,1-6H3,(H,26,30)/t19-,20+,23-/m1/s1 |
| InChIKey | IBWQKZVMTHJIOS-ZRCGQRJVSA-N |
| XLogP | 2.90 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|