C28H36FN3O5S — CID 54627323
3-(2-fluorophenyl)-1-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea (PubChem CID 54627323) has the molecular formula C28H36FN3O5S and a molecular weight of 545.68 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea.
| Compound Name | 3-(2-fluorophenyl)-1-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 54627323 |
| Molecular Formula | C28H36FN3O5S |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 3-(2-fluorophenyl)-1-[[(4S,5S)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-8-(4-methylpent-1-ynyl)-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-1-methylurea |
| SMILES | CC(C)CC#Cc1ccc2c(c1)O[C@H](CN(C)C(=O)Nc1ccccc1F)[C@@H](C)CN([C@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C28H36FN3O5S/c1-19(2)9-8-10-22-13-14-27-25(15-22)37-26(20(3)16-32(21(4)18-33)38(27,35)36)17-31(5)28(34)30-24-12-7-6-11-23(24)29/h6-7,11-15,19-21,26,33H,9,16-18H2,1-5H3,(H,30,34)/t20-,21+,26+/m0/s1 |
| InChIKey | VVRFXHTVMAXUPI-LZCXECNNSA-N |
| XLogP | 4.16 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|