C27H35FN4O5S — CID 54625910
1-[[(4R,5R)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(2-fluorophenyl)-1-methylurea (PubChem CID 54625910) has the molecular formula C27H35FN4O5S and a molecular weight of 546.67 g/mol. Its IUPAC name is 1-[[(4R,5R)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(2-fluorophenyl)-1-methylurea.
| Compound Name | 1-[[(4R,5R)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(2-fluorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 54625910 |
| Molecular Formula | C27H35FN4O5S |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 1-[[(4R,5R)-8-[3-(dimethylamino)prop-1-ynyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(2-fluorophenyl)-1-methylurea |
| SMILES | C[C@@H]1CN([C@H](C)CO)S(=O)(=O)c2ccc(C#CCN(C)C)cc2O[C@H]1CN(C)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C27H35FN4O5S/c1-19-16-32(20(2)18-33)38(35,36)26-13-12-21(9-8-14-30(3)4)15-24(26)37-25(19)17-31(5)27(34)29-23-11-7-6-10-22(23)28/h6-7,10-13,15,19-20,25,33H,14,16-18H2,1-5H3,(H,29,34)/t19-,20-,25+/m1/s1 |
| InChIKey | WTZFPAOWLGXJSK-FHAGJXEFSA-N |
| XLogP | 2.67 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|