C24H32N2O6S — CID 54626294
N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-8-(4-methoxyphenyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide (PubChem CID 54626294) has the molecular formula C24H32N2O6S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-8-(4-methoxyphenyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide.
| Compound Name | N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-8-(4-methoxyphenyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 54626294 |
| Molecular Formula | C24H32N2O6S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-[[(4R,5R)-2-[(2S)-1-hydroxypropan-2-yl]-8-(4-methoxyphenyl)-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide |
| SMILES | COc1ccc(-c2ccc3c(c2)O[C@@H](CN(C)C(C)=O)[C@H](C)CN([C@@H](C)CO)S3(=O)=O)cc1 |
| InChI | InChI=1S/C24H32N2O6S/c1-16-13-26(17(2)15-27)33(29,30)24-11-8-20(19-6-9-21(31-5)10-7-19)12-22(24)32-23(16)14-25(4)18(3)28/h6-12,16-17,23,27H,13-15H2,1-5H3/t16-,17+,23+/m1/s1 |
| InChIKey | YVHLBRHYQCCGNE-DGGJZMOXSA-N |
| XLogP | 2.61 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |