C35H40N2O5S — CID 73456650
(2S)-2-[(4S,5R)-8-(4-methoxyphenyl)-4-methyl-5-[[methyl-[(4-phenylphenyl)methyl]amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 73456650) has the molecular formula C35H40N2O5S and a molecular weight of 600.78 g/mol. Its IUPAC name is (2S)-2-[(4S,5R)-8-(4-methoxyphenyl)-4-methyl-5-[[methyl-[(4-phenylphenyl)methyl]amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2S)-2-[(4S,5R)-8-(4-methoxyphenyl)-4-methyl-5-[[methyl-[(4-phenylphenyl)methyl]amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 73456650 |
| Molecular Formula | C35H40N2O5S |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | (2S)-2-[(4S,5R)-8-(4-methoxyphenyl)-4-methyl-5-[[methyl-[(4-phenylphenyl)methyl]amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | COc1ccc(-c2ccc3c(c2)O[C@@H](CN(C)Cc2ccc(-c4ccccc4)cc2)[C@@H](C)CN([C@@H](C)CO)S3(=O)=O)cc1 |
| InChI | InChI=1S/C35H40N2O5S/c1-25-21-37(26(2)24-38)43(39,40)35-19-16-31(30-14-17-32(41-4)18-15-30)20-33(35)42-34(25)23-36(3)22-27-10-12-29(13-11-27)28-8-6-5-7-9-28/h5-20,25-26,34,38H,21-24H2,1-4H3/t25-,26-,34-/m0/s1 |
| InChIKey | ILOOLIIILDYCDK-KTYLLXISSA-N |
| XLogP | 5.93 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |