C14H24N2O7 — CID 546296
7,16-dimethyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-2,6,17-trione (PubChem CID 546296) has the molecular formula C14H24N2O7 and a molecular weight of 332.35 g/mol. Its IUPAC name is 7,16-dimethyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-2,6,17-trione.
| Compound Name | 7,16-dimethyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-2,6,17-trione |
|---|---|
| PubChem CID | 546296 |
| Molecular Formula | C14H24N2O7 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 7,16-dimethyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane-2,6,17-trione |
| SMILES | CN1CCOCCOCCN(C)C(=O)COC(=O)COCC1=O |
| InChI | InChI=1S/C14H24N2O7/c1-15-3-5-20-7-8-21-6-4-16(2)13(18)10-23-14(19)11-22-9-12(15)17/h3-11H2,1-2H3 |
| InChIKey | FBUUEPQZNIDYQB-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |