C25H38N2O4S — CID 54631028
(2S)-2-[(4R,5R)-8-(2-cyclopentylethynyl)-4-methyl-5-[[methyl(propyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 54631028) has the molecular formula C25H38N2O4S and a molecular weight of 462.66 g/mol. Its IUPAC name is (2S)-2-[(4R,5R)-8-(2-cyclopentylethynyl)-4-methyl-5-[[methyl(propyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2S)-2-[(4R,5R)-8-(2-cyclopentylethynyl)-4-methyl-5-[[methyl(propyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54631028 |
| Molecular Formula | C25H38N2O4S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (2S)-2-[(4R,5R)-8-(2-cyclopentylethynyl)-4-methyl-5-[[methyl(propyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | CCCN(C)C[C@@H]1Oc2cc(C#CC3CCCC3)ccc2S(=O)(=O)N([C@@H](C)CO)C[C@H]1C |
| InChI | InChI=1S/C25H38N2O4S/c1-5-14-26(4)17-24-19(2)16-27(20(3)18-28)32(29,30)25-13-12-22(15-23(25)31-24)11-10-21-8-6-7-9-21/h12-13,15,19-21,24,28H,5-9,14,16-18H2,1-4H3/t19-,20+,24+/m1/s1 |
| InChIKey | ILRCKDSAMGDBNJ-NMMYMHLASA-N |
| XLogP | 3.34 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|