C34H40N4O4 — CID 54631176
1-[[(2R,3S)-8-(3-cyclopentylprop-1-ynyl)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methyl-3-naphthalen-1-ylurea (PubChem CID 54631176) has the molecular formula C34H40N4O4 and a molecular weight of 568.72 g/mol. Its IUPAC name is 1-[[(2R,3S)-8-(3-cyclopentylprop-1-ynyl)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methyl-3-naphthalen-1-ylurea.
| Compound Name | 1-[[(2R,3S)-8-(3-cyclopentylprop-1-ynyl)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methyl-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 54631176 |
| Molecular Formula | C34H40N4O4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 1-[[(2R,3S)-8-(3-cyclopentylprop-1-ynyl)-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-pyrido[2,3-b][1,5]oxazocin-2-yl]methyl]-1-methyl-3-naphthalen-1-ylurea |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@H](CN(C)C(=O)Nc2cccc3ccccc23)Oc2ncc(C#CCC3CCCC3)cc2C1=O |
| InChI | InChI=1S/C34H40N4O4/c1-23-20-38(24(2)22-39)33(40)29-18-26(13-8-12-25-10-4-5-11-25)19-35-32(29)42-31(23)21-37(3)34(41)36-30-17-9-15-27-14-6-7-16-28(27)30/h6-7,9,14-19,23-25,31,39H,4-5,10-12,20-22H2,1-3H3,(H,36,41)/t23-,24+,31-/m0/s1 |
| InChIKey | UEOAGINGSYPFCM-JLELKNTQSA-N |
| XLogP | 5.55 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|